C18H17F2N3O2S2 — CID 6905379
(E)-4-[4-(difluoromethoxy)phenyl]-N-(2-methoxyethyl)-3-[(E)-thiophen-3-ylmethylideneamino]-1,3-thiazol-2-imine (PubChem CID 6905379) has the molecular formula C18H17F2N3O2S2 and a molecular weight of 409.48 g/mol. Its IUPAC name is (E)-4-[4-(difluoromethoxy)phenyl]-N-(2-methoxyethyl)-3-[(E)-thiophen-3-ylmethylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (E)-4-[4-(difluoromethoxy)phenyl]-N-(2-methoxyethyl)-3-[(E)-thiophen-3-ylmethylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6905379 |
| Molecular Formula | C18H17F2N3O2S2 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | (E)-4-[4-(difluoromethoxy)phenyl]-N-(2-methoxyethyl)-3-[(E)-thiophen-3-ylmethylideneamino]-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2ccc(OC(F)F)cc2)n1/N=C/c1ccsc1 |
| InChI | InChI=1S/C18H17F2N3O2S2/c1-24-8-7-21-18-23(22-10-13-6-9-26-11-13)16(12-27-18)14-2-4-15(5-3-14)25-17(19)20/h2-6,9-12,17H,7-8H2,1H3/b21-18-,22-10+ |
| InChIKey | HTFXXVLAFHGICV-HNRAKDTKSA-N |
| XLogP | 4.31 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|