C20H16F3N3OS — CID 6903469
(E)-4-[4-(difluoromethoxy)phenyl]-3-[(E)-(4-fluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 6903469) has the molecular formula C20H16F3N3OS and a molecular weight of 403.43 g/mol. Its IUPAC name is (E)-4-[4-(difluoromethoxy)phenyl]-3-[(E)-(4-fluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | (E)-4-[4-(difluoromethoxy)phenyl]-3-[(E)-(4-fluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6903469 |
| Molecular Formula | C20H16F3N3OS |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (E)-4-[4-(difluoromethoxy)phenyl]-3-[(E)-(4-fluorophenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(OC(F)F)cc2)n1/N=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16F3N3OS/c1-2-11-24-20-26(25-12-14-3-7-16(21)8-4-14)18(13-28-20)15-5-9-17(10-6-15)27-19(22)23/h2-10,12-13,19H,1,11H2/b24-20-,25-12+ |
| InChIKey | IIZFJFFAWYULFW-DKECESECSA-N |
| XLogP | 4.93 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|