C20H18FN3S2 — CID 2401260
4-(4-fluorophenyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 2401260) has the molecular formula C20H18FN3S2 and a molecular weight of 383.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-(4-fluorophenyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2401260 |
| Molecular Formula | C20H18FN3S2 |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-(4-fluorophenyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(F)cc2)n1N=Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C20H18FN3S2/c1-3-12-22-20-24(23-13-15-4-10-18(25-2)11-5-15)19(14-26-20)16-6-8-17(21)9-7-16/h3-11,13-14H,1,12H2,2H3/b22-20-,23-13? |
| InChIKey | SFLCGSRGGSCZMR-JKSDFIRWSA-N |
| XLogP | 5.05 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|