C18H14Cl2N4S — CID 23882854
4-(3,4-dichlorophenyl)-N-prop-2-enyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23882854) has the molecular formula C18H14Cl2N4S and a molecular weight of 389.31 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-prop-2-enyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-prop-2-enyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23882854 |
| Molecular Formula | C18H14Cl2N4S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-prop-2-enyl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(Cl)c(Cl)c2)n1N=Cc1ccncc1 |
| InChI | InChI=1S/C18H14Cl2N4S/c1-2-7-22-18-24(23-11-13-5-8-21-9-6-13)17(12-25-18)14-3-4-15(19)16(20)10-14/h2-6,8-12H,1,7H2/b22-18-,23-11? |
| InChIKey | ZXSZFSHZIDMTFY-RIBHSPTRSA-N |
| XLogP | 4.89 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|