C18H16Cl2N4S — CID 23770083
4-(3,4-dichlorophenyl)-N-propan-2-yl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23770083) has the molecular formula C18H16Cl2N4S and a molecular weight of 391.33 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-propan-2-yl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-propan-2-yl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23770083 |
| Molecular Formula | C18H16Cl2N4S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-propan-2-yl-3-(pyridin-4-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | CC(C)/N=c1\scc(-c2ccc(Cl)c(Cl)c2)n1N=Cc1ccncc1 |
| InChI | InChI=1S/C18H16Cl2N4S/c1-12(2)23-18-24(22-10-13-5-7-21-8-6-13)17(11-25-18)14-3-4-15(19)16(20)9-14/h3-12H,1-2H3/b22-10?,23-18- |
| InChIKey | IXMWJRPOCRSNAQ-DUYSQUPQSA-N |
| XLogP | 5.11 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|