C24H26FN3O2S — CID 4039525
2-[N-[2-cyclohexylimino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]-5-methoxyphenol (PubChem CID 4039525) has the molecular formula C24H26FN3O2S and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[N-[2-cyclohexylimino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]-5-methoxyphenol.
| Compound Name | 2-[N-[2-cyclohexylimino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 4039525 |
| Molecular Formula | C24H26FN3O2S |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-[N-[2-cyclohexylimino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]-5-methoxyphenol |
| SMILES | COc1ccc(C(C)=Nn2c(-c3ccc(F)cc3)cs/c2=N\C2CCCCC2)c(O)c1 |
| InChI | InChI=1S/C24H26FN3O2S/c1-16(21-13-12-20(30-2)14-23(21)29)27-28-22(17-8-10-18(25)11-9-17)15-31-24(28)26-19-6-4-3-5-7-19/h8-15,19,29H,3-7H2,1-2H3/b26-24-,27-16? |
| InChIKey | ZLKUZECIAXJDNY-KZZIXVDKSA-N |
| XLogP | 5.58 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|