C20H20FN3O2S — CID 23767050
3-[1-(2,4-dimethoxyphenyl)ethylideneamino]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-imine (PubChem CID 23767050) has the molecular formula C20H20FN3O2S and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-[1-(2,4-dimethoxyphenyl)ethylideneamino]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(2,4-dimethoxyphenyl)ethylideneamino]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23767050 |
| Molecular Formula | C20H20FN3O2S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 3-[1-(2,4-dimethoxyphenyl)ethylideneamino]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(F)cc2)n1N=C(C)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C20H20FN3O2S/c1-13(17-10-9-16(25-3)11-19(17)26-4)23-24-18(12-27-20(24)22-2)14-5-7-15(21)8-6-14/h5-12H,1-4H3/b22-20-,23-13? |
| InChIKey | QDAZRCVJAZZLCH-JKSDFIRWSA-N |
| XLogP | 4.18 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|