C23H24FN3O2S — CID 23905208
3-[1-(3,4-dimethoxyphenyl)ethylideneamino]-4-(4-fluorophenyl)-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine (PubChem CID 23905208) has the molecular formula C23H24FN3O2S and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-[1-(3,4-dimethoxyphenyl)ethylideneamino]-4-(4-fluorophenyl)-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(3,4-dimethoxyphenyl)ethylideneamino]-4-(4-fluorophenyl)-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23905208 |
| Molecular Formula | C23H24FN3O2S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[1-(3,4-dimethoxyphenyl)ethylideneamino]-4-(4-fluorophenyl)-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine |
| SMILES | C=C(C)C/N=c1\scc(-c2ccc(F)cc2)n1N=C(C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H24FN3O2S/c1-15(2)13-25-23-27(20(14-30-23)17-6-9-19(24)10-7-17)26-16(3)18-8-11-21(28-4)22(12-18)29-5/h6-12,14H,1,13H2,2-5H3/b25-23-,26-16? |
| InChIKey | NQUYWPARQUQMIA-DTDPTEKQSA-N |
| XLogP | 5.12 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|