C20H27N3O2S — CID 23994084
4-(2,5-dimethoxyphenyl)-N-(2-methylprop-2-enyl)-3-(pentan-3-ylideneamino)-1,3-thiazol-2-imine (PubChem CID 23994084) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N-(2-methylprop-2-enyl)-3-(pentan-3-ylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N-(2-methylprop-2-enyl)-3-(pentan-3-ylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23994084 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N-(2-methylprop-2-enyl)-3-(pentan-3-ylideneamino)-1,3-thiazol-2-imine |
| SMILES | C=C(C)C/N=c1\scc(-c2cc(OC)ccc2OC)n1N=C(CC)CC |
| InChI | InChI=1S/C20H27N3O2S/c1-7-15(8-2)22-23-18(13-26-20(23)21-12-14(3)4)17-11-16(24-5)9-10-19(17)25-6/h9-11,13H,3,7-8,12H2,1-2,4-6H3/b21-20- |
| InChIKey | ZPXUXFYPPTYJNV-MRCUWXFGSA-N |
| XLogP | 4.73 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|