C23H25N3O5S — CID 46698799
4-[3-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-(oxolan-2-ylmethylimino)-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 46698799) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 4-[3-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-(oxolan-2-ylmethylimino)-1,3-thiazol-4-yl]benzene-1,3-diol.
| Compound Name | 4-[3-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-(oxolan-2-ylmethylimino)-1,3-thiazol-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 46698799 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 4-[3-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-(oxolan-2-ylmethylimino)-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | COc1ccc(/C=N/n2c(-c3ccc(O)cc3O)cs/c2=N\CC2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C23H25N3O5S/c1-29-17-7-5-15(22(11-17)30-2)12-25-26-20(19-8-6-16(27)10-21(19)28)14-32-23(26)24-13-18-4-3-9-31-18/h5-8,10-12,14,18,27-28H,3-4,9,13H2,1-2H3/b24-23-,25-12+ |
| InChIKey | PIPOAOLTXXUXFC-ZVKOUPCOSA-N |
| XLogP | 3.61 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|