C20H16Cl2N4OS — CID 6902479
4-[(E)-[4-(2,4-dichlorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile (PubChem CID 6902479) has the molecular formula C20H16Cl2N4OS and a molecular weight of 431.35 g/mol. Its IUPAC name is 4-[(E)-[4-(2,4-dichlorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile.
| Compound Name | 4-[(E)-[4-(2,4-dichlorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 6902479 |
| Molecular Formula | C20H16Cl2N4OS |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 4-[(E)-[4-(2,4-dichlorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| SMILES | COCC/N=c1\scc(-c2ccc(Cl)cc2Cl)n1/N=C/c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H16Cl2N4OS/c1-27-9-8-24-20-26(25-12-15-4-2-14(11-23)3-5-15)19(13-28-20)17-7-6-16(21)10-18(17)22/h2-7,10,12-13H,8-9H2,1H3/b24-20-,25-12+ |
| InChIKey | YXZFFZSQFHPKQX-DKECESECSA-N |
| XLogP | 4.82 |
| TPSA | 62.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|