C21H20FN3S2 — CID 23790499
4-(2-fluorophenyl)-N-(2-methylprop-2-enyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23790499) has the molecular formula C21H20FN3S2 and a molecular weight of 397.54 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N-(2-methylprop-2-enyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(2-fluorophenyl)-N-(2-methylprop-2-enyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23790499 |
| Molecular Formula | C21H20FN3S2 |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-(2-fluorophenyl)-N-(2-methylprop-2-enyl)-3-[(4-methylsulfanylphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C=C(C)C/N=c1\scc(-c2ccccc2F)n1N=Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C21H20FN3S2/c1-15(2)12-23-21-25(24-13-16-8-10-17(26-3)11-9-16)20(14-27-21)18-6-4-5-7-19(18)22/h4-11,13-14H,1,12H2,2-3H3/b23-21-,24-13? |
| InChIKey | WDACIIVXKUBSGX-NYHUNQEVSA-N |
| XLogP | 5.44 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|