C17H12F3N3S — CID 45115437
3-[(2,6-difluorophenyl)methylideneamino]-4-(2-fluorophenyl)-N-methyl-1,3-thiazol-2-imine (PubChem CID 45115437) has the molecular formula C17H12F3N3S and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-[(2,6-difluorophenyl)methylideneamino]-4-(2-fluorophenyl)-N-methyl-1,3-thiazol-2-imine.
| Compound Name | 3-[(2,6-difluorophenyl)methylideneamino]-4-(2-fluorophenyl)-N-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 45115437 |
| Molecular Formula | C17H12F3N3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 3-[(2,6-difluorophenyl)methylideneamino]-4-(2-fluorophenyl)-N-methyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccccc2F)n1N=Cc1c(F)cccc1F |
| InChI | InChI=1S/C17H12F3N3S/c1-21-17-23(22-9-12-14(19)7-4-8-15(12)20)16(10-24-17)11-5-2-3-6-13(11)18/h2-10H,1H3/b21-17-,22-9? |
| InChIKey | GSIKNQJHWJZXGB-NEFDEOENSA-N |
| XLogP | 4.05 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|