C19H19N3S2 — CID 23736817
N-benzyl-4-methyl-3-[(4-methylsulfanylphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23736817) has the molecular formula C19H19N3S2 and a molecular weight of 353.52 g/mol. Its IUPAC name is N-benzyl-4-methyl-3-[(4-methylsulfanylphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | N-benzyl-4-methyl-3-[(4-methylsulfanylphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23736817 |
| Molecular Formula | C19H19N3S2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-benzyl-4-methyl-3-[(4-methylsulfanylphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | CSc1ccc(C=Nn2c(C)cs/c2=N\Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3S2/c1-15-14-24-19(20-12-16-6-4-3-5-7-16)22(15)21-13-17-8-10-18(23-2)11-9-17/h3-11,13-14H,12H2,1-2H3/b20-19-,21-13? |
| InChIKey | FWGXTEAQEATFBN-XLCBZCFXSA-N |
| XLogP | 4.56 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|