C13H12N4S — CID 2455890
4-[(4-methyl-2-methylimino-1,3-thiazol-3-yl)iminomethyl]benzonitrile (PubChem CID 2455890) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-[(4-methyl-2-methylimino-1,3-thiazol-3-yl)iminomethyl]benzonitrile.
| Compound Name | 4-[(4-methyl-2-methylimino-1,3-thiazol-3-yl)iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 2455890 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-[(4-methyl-2-methylimino-1,3-thiazol-3-yl)iminomethyl]benzonitrile |
| SMILES | C/N=c1\scc(C)n1N=Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H12N4S/c1-10-9-18-13(15-2)17(10)16-8-12-5-3-11(7-14)4-6-12/h3-6,8-9H,1-2H3/b15-13-,16-8? |
| InChIKey | SQJVMCLJTUSWBE-KZTBFIMMSA-N |
| XLogP | 2.14 |
| TPSA | 53.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|