C14H14N4S — CID 135676704
3-(1H-indol-3-ylmethylideneamino)-N,4-dimethyl-1,3-thiazol-2-imine (PubChem CID 135676704) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 3-(1H-indol-3-ylmethylideneamino)-N,4-dimethyl-1,3-thiazol-2-imine.
| Compound Name | 3-(1H-indol-3-ylmethylideneamino)-N,4-dimethyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135676704 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-(1H-indol-3-ylmethylideneamino)-N,4-dimethyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(C)n1N=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H14N4S/c1-10-9-19-14(15-2)18(10)17-8-11-7-16-13-6-4-3-5-12(11)13/h3-9,16H,1-2H3/b15-14-,17-8? |
| InChIKey | ANMXYQYOQPFEFM-HAKNRFHJSA-N |
| XLogP | 2.75 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|