C27H25N3OS — CID 23734721
3-(2,2-diphenylethylideneamino)-4-(2-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23734721) has the molecular formula C27H25N3OS and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-(2,2-diphenylethylideneamino)-4-(2-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 3-(2,2-diphenylethylideneamino)-4-(2-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23734721 |
| Molecular Formula | C27H25N3OS |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 3-(2,2-diphenylethylideneamino)-4-(2-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccccc2OC)n1N=CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25N3OS/c1-3-18-28-27-30(25(20-32-27)23-16-10-11-17-26(23)31-2)29-19-24(21-12-6-4-7-13-21)22-14-8-5-9-15-22/h3-17,19-20,24H,1,18H2,2H3/b28-27-,29-19? |
| InChIKey | FUBUXMHHQJVPSJ-AIBGTVEISA-N |
| XLogP | 5.98 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|