C23H23N3O3S — CID 23932545
3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-(2-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23932545) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-(2-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-(2-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23932545 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-(2-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccccc2OC)n1N=C(C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H23N3O3S/c1-4-11-24-23-26(19(15-30-23)18-7-5-6-8-20(18)27-3)25-16(2)17-9-10-21-22(14-17)29-13-12-28-21/h4-10,14-15H,1,11-13H2,2-3H3/b24-23-,25-16? |
| InChIKey | CBMAODUYCGQNTA-CTQCDUDSSA-N |
| XLogP | 4.36 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|