C27H25N3O3S — CID 23847728
N-benzyl-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-(2-methoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23847728) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-benzyl-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-(2-methoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-benzyl-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-(2-methoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23847728 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-benzyl-3-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-(2-methoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccccc1-c1cs/c(=N\Cc2ccccc2)n1N=C(C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C27H25N3O3S/c1-19(21-12-13-25-26(16-21)33-15-14-32-25)29-30-23(22-10-6-7-11-24(22)31-2)18-34-27(30)28-17-20-8-4-3-5-9-20/h3-13,16,18H,14-15,17H2,1-2H3/b28-27-,29-19? |
| InChIKey | HZKPIOJZBIMTTC-AIBGTVEISA-N |
| XLogP | 5.37 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|