C19H16BrN3O2S — CID 23770546
3-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-(2-bromophenyl)-N-methyl-1,3-thiazol-2-imine (PubChem CID 23770546) has the molecular formula C19H16BrN3O2S and a molecular weight of 430.33 g/mol. Its IUPAC name is 3-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-(2-bromophenyl)-N-methyl-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-(2-bromophenyl)-N-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23770546 |
| Molecular Formula | C19H16BrN3O2S |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 3-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-(2-bromophenyl)-N-methyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccccc2Br)n1N=C(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16BrN3O2S/c1-12(13-7-8-17-18(9-13)25-11-24-17)22-23-16(10-26-19(23)21-2)14-5-3-4-6-15(14)20/h3-10H,11H2,1-2H3/b21-19-,22-12? |
| InChIKey | FIWFUBOLNIRKFH-UCTLZQNBSA-N |
| XLogP | 4.51 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|