C20H20N6O2S — CID 8825768
N-[3-acetamido-4-[2-methylimino-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-4-yl]phenyl]acetamide (PubChem CID 8825768) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is N-[3-acetamido-4-[2-methylimino-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-4-yl]phenyl]acetamide.
| Compound Name | N-[3-acetamido-4-[2-methylimino-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 8825768 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[3-acetamido-4-[2-methylimino-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-4-yl]phenyl]acetamide |
| SMILES | C/N=c1\scc(-c2ccc(NC(C)=O)cc2NC(C)=O)n1/N=C\c1ccccn1 |
| InChI | InChI=1S/C20H20N6O2S/c1-13(27)24-15-7-8-17(18(10-15)25-14(2)28)19-12-29-20(21-3)26(19)23-11-16-6-4-5-9-22-16/h4-12H,1-3H3,(H,24,27)(H,25,28)/b21-20-,23-11- |
| InChIKey | DHMDIDCMCRHZTH-HLEBHENOSA-N |
| XLogP | 2.94 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|