C19H17N5O2S — CID 8716107
2-hydroxy-5-[2-prop-2-enylimino-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-4-yl]benzamide (PubChem CID 8716107) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 2-hydroxy-5-[2-prop-2-enylimino-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-4-yl]benzamide.
| Compound Name | 2-hydroxy-5-[2-prop-2-enylimino-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 8716107 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-hydroxy-5-[2-prop-2-enylimino-3-[(Z)-pyridin-2-ylmethylideneamino]-1,3-thiazol-4-yl]benzamide |
| SMILES | C=CC/N=c1\scc(-c2ccc(O)c(C(N)=O)c2)n1/N=C\c1ccccn1 |
| InChI | InChI=1S/C19H17N5O2S/c1-2-8-22-19-24(23-11-14-5-3-4-9-21-14)16(12-27-19)13-6-7-17(25)15(10-13)18(20)26/h2-7,9-12,25H,1,8H2,(H2,20,26)/b22-19-,23-11- |
| InChIKey | QSHWQLVKANIQFU-CJIXGZIISA-N |
| XLogP | 2.38 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|