C22H17BrN4S — CID 23992225
N-benzyl-4-(4-bromophenyl)-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23992225) has the molecular formula C22H17BrN4S and a molecular weight of 449.38 g/mol. Its IUPAC name is N-benzyl-4-(4-bromophenyl)-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N-benzyl-4-(4-bromophenyl)-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23992225 |
| Molecular Formula | C22H17BrN4S |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | N-benzyl-4-(4-bromophenyl)-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | Brc1ccc(-c2cs/c(=N\Cc3ccccc3)n2N=Cc2ccccn2)cc1 |
| InChI | InChI=1S/C22H17BrN4S/c23-19-11-9-18(10-12-19)21-16-28-22(25-14-17-6-2-1-3-7-17)27(21)26-15-20-8-4-5-13-24-20/h1-13,15-16H,14H2/b25-22-,26-15? |
| InChIKey | BVLAYDFBCIMZHW-BTKBRLNJSA-N |
| XLogP | 5.36 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|