C21H15BrN4S — CID 2455204
4-(3-bromophenyl)-N-phenyl-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 2455204) has the molecular formula C21H15BrN4S and a molecular weight of 435.35 g/mol. Its IUPAC name is 4-(3-bromophenyl)-N-phenyl-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(3-bromophenyl)-N-phenyl-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2455204 |
| Molecular Formula | C21H15BrN4S |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 4-(3-bromophenyl)-N-phenyl-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | Brc1cccc(-c2cs/c(=N\c3ccccc3)n2N=Cc2ccccn2)c1 |
| InChI | InChI=1S/C21H15BrN4S/c22-17-8-6-7-16(13-17)20-15-27-21(25-18-9-2-1-3-10-18)26(20)24-14-19-11-4-5-12-23-19/h1-15H/b24-14?,25-21- |
| InChIKey | QGGVQMPHICHFDG-RSDZEHHHSA-N |
| XLogP | 5.49 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|