C21H15BrN4O3S — CID 135823313
4-[[4-(3-bromophenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol (PubChem CID 135823313) has the molecular formula C21H15BrN4O3S and a molecular weight of 483.35 g/mol. Its IUPAC name is 4-[[4-(3-bromophenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol.
| Compound Name | 4-[[4-(3-bromophenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135823313 |
| Molecular Formula | C21H15BrN4O3S |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 4-[[4-(3-bromophenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(C=Nn2c(-c3cccc(Br)c3)cs/c2=N\c2cccnc2)c(O)c1O |
| InChI | InChI=1S/C21H15BrN4O3S/c22-15-4-1-3-13(9-15)17-12-30-21(25-16-5-2-8-23-11-16)26(17)24-10-14-6-7-18(27)20(29)19(14)28/h1-12,27-29H/b24-10?,25-21- |
| InChIKey | YBZYODXSBVFWOV-VNUGEMKZSA-N |
| XLogP | 4.61 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|