C22H18BrN3S — CID 23908951
4-(3-bromophenyl)-3-(1-phenylethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine (PubChem CID 23908951) has the molecular formula C22H18BrN3S and a molecular weight of 436.38 g/mol. Its IUPAC name is 4-(3-bromophenyl)-3-(1-phenylethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine.
| Compound Name | 4-(3-bromophenyl)-3-(1-phenylethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23908951 |
| Molecular Formula | C22H18BrN3S |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 4-(3-bromophenyl)-3-(1-phenylethyl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
| SMILES | CC(c1ccccc1)n1c(-c2cccc(Br)c2)cs/c1=N\c1cccnc1 |
| InChI | InChI=1S/C22H18BrN3S/c1-16(17-7-3-2-4-8-17)26-21(18-9-5-10-19(23)13-18)15-27-22(26)25-20-11-6-12-24-14-20/h2-16H,1H3/b25-22- |
| InChIKey | YBNPTIZUYOIWHD-LVWGJNHUSA-N |
| XLogP | 6.22 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|