C24H31N3O3S — CID 23964269
3-(5-methylhexan-2-yl)-N-pyridin-3-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23964269) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is 3-(5-methylhexan-2-yl)-N-pyridin-3-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(5-methylhexan-2-yl)-N-pyridin-3-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23964269 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 3-(5-methylhexan-2-yl)-N-pyridin-3-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1cc(-c2cs/c(=N\c3cccnc3)n2C(C)CCC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C24H31N3O3S/c1-16(2)9-10-17(3)27-20(15-31-24(27)26-19-8-7-11-25-14-19)18-12-21(28-4)23(30-6)22(13-18)29-5/h7-8,11-17H,9-10H2,1-6H3/b26-24- |
| InChIKey | BHOLCPQVHBTORE-LCUIJRPUSA-N |
| XLogP | 5.87 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|