C22H24F2N2O3S — CID 23854073
3-butan-2-yl-N-(2,4-difluorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23854073) has the molecular formula C22H24F2N2O3S and a molecular weight of 434.51 g/mol. Its IUPAC name is 3-butan-2-yl-N-(2,4-difluorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-butan-2-yl-N-(2,4-difluorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23854073 |
| Molecular Formula | C22H24F2N2O3S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-butan-2-yl-N-(2,4-difluorophenyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | CCC(C)n1c(-c2cc(OC)c(OC)c(OC)c2)cs/c1=N\c1ccc(F)cc1F |
| InChI | InChI=1S/C22H24F2N2O3S/c1-6-13(2)26-18(14-9-19(27-3)21(29-5)20(10-14)28-4)12-30-22(26)25-17-8-7-15(23)11-16(17)24/h7-13H,6H2,1-5H3/b25-22- |
| InChIKey | HZSFXCFUFLMLGU-LVWGJNHUSA-N |
| XLogP | 5.72 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|