C23H26F2N2O3S — CID 23988621
N-(2,4-difluorophenyl)-3-(3-methylbutyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23988621) has the molecular formula C23H26F2N2O3S and a molecular weight of 448.54 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-(3-methylbutyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2,4-difluorophenyl)-3-(3-methylbutyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23988621 |
| Molecular Formula | C23H26F2N2O3S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-(3-methylbutyl)-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1cc(-c2cs/c(=N\c3ccc(F)cc3F)n2CCC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C23H26F2N2O3S/c1-14(2)8-9-27-19(15-10-20(28-3)22(30-5)21(11-15)29-4)13-31-23(27)26-18-7-6-16(24)12-17(18)25/h6-7,10-14H,8-9H2,1-5H3/b26-23- |
| InChIKey | OWGVWGPYTAJARV-RWEWTDSWSA-N |
| XLogP | 5.80 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|