C23H23ClFN3O5S — CID 20815262
2-[2-[3-[2-(4-chloro-2-methoxyphenyl)imino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]propylamino]-2-oxoethoxy]acetic acid (PubChem CID 20815262) has the molecular formula C23H23ClFN3O5S and a molecular weight of 507.97 g/mol. Its IUPAC name is 2-[2-[3-[2-(4-chloro-2-methoxyphenyl)imino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]propylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[3-[2-(4-chloro-2-methoxyphenyl)imino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]propylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 20815262 |
| Molecular Formula | C23H23ClFN3O5S |
| Molecular Weight | 507.97 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-[2-[3-[2-(4-chloro-2-methoxyphenyl)imino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]propylamino]-2-oxoethoxy]acetic acid |
| SMILES | COc1cc(Cl)ccc1/N=c1\scc(-c2ccc(F)cc2)n1CCCNC(=O)COCC(=O)O |
| InChI | InChI=1S/C23H23ClFN3O5S/c1-32-20-11-16(24)5-8-18(20)27-23-28(10-2-9-26-21(29)12-33-13-22(30)31)19(14-34-23)15-3-6-17(25)7-4-15/h3-8,11,14H,2,9-10,12-13H2,1H3,(H,26,29)(H,30,31)/b27-23- |
| InChIKey | JCZLHOPADRBGOA-VYIQYICTSA-N |
| XLogP | 3.86 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.97 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|