C22H25ClFN3OS — CID 20815335
3-[3-[2-(4-chloro-2-methylphenyl)imino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]propylamino]propan-1-ol (PubChem CID 20815335) has the molecular formula C22H25ClFN3OS and a molecular weight of 433.98 g/mol. Its IUPAC name is 3-[3-[2-(4-chloro-2-methylphenyl)imino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]propylamino]propan-1-ol.
| Compound Name | 3-[3-[2-(4-chloro-2-methylphenyl)imino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]propylamino]propan-1-ol |
|---|---|
| PubChem CID | 20815335 |
| Molecular Formula | C22H25ClFN3OS |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3-[3-[2-(4-chloro-2-methylphenyl)imino-4-(4-fluorophenyl)-1,3-thiazol-3-yl]propylamino]propan-1-ol |
| SMILES | Cc1cc(Cl)ccc1/N=c1\scc(-c2ccc(F)cc2)n1CCCNCCCO |
| InChI | InChI=1S/C22H25ClFN3OS/c1-16-14-18(23)6-9-20(16)26-22-27(12-2-10-25-11-3-13-28)21(15-29-22)17-4-7-19(24)8-5-17/h4-9,14-15,25,28H,2-3,10-13H2,1H3/b26-22- |
| InChIKey | IGAHXIPUWZTGAG-ROMGYVFFSA-N |
| XLogP | 4.91 |
| TPSA | 49.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|