C24H23ClF3N3O4S — CID 20815321
[2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-2-oxoethyl] acetate (PubChem CID 20815321) has the molecular formula C24H23ClF3N3O4S and a molecular weight of 541.98 g/mol. Its IUPAC name is [2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-2-oxoethyl] acetate.
| Compound Name | [2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 20815321 |
| Molecular Formula | C24H23ClF3N3O4S |
| Molecular Weight | 541.98 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | [2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)NCCCn1c(-c2ccc(OC(F)(F)F)cc2)cs/c1=N\Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClF3N3O4S/c1-16(32)34-14-22(33)29-11-2-12-31-21(18-5-9-20(10-6-18)35-24(26,27)28)15-36-23(31)30-13-17-3-7-19(25)8-4-17/h3-10,15H,2,11-14H2,1H3,(H,29,33)/b30-23- |
| InChIKey | AVBNJYYTDLOIBP-WMMMYUQOSA-N |
| XLogP | 4.94 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|