C26H29F3N4O4S — CID 20815302
2-methoxy-N-[3-[4-(4-morpholin-4-ylphenyl)-2-[4-(trifluoromethoxy)phenyl]imino-1,3-thiazol-3-yl]propyl]acetamide (PubChem CID 20815302) has the molecular formula C26H29F3N4O4S and a molecular weight of 550.60 g/mol. Its IUPAC name is 2-methoxy-N-[3-[4-(4-morpholin-4-ylphenyl)-2-[4-(trifluoromethoxy)phenyl]imino-1,3-thiazol-3-yl]propyl]acetamide.
| Compound Name | 2-methoxy-N-[3-[4-(4-morpholin-4-ylphenyl)-2-[4-(trifluoromethoxy)phenyl]imino-1,3-thiazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 20815302 |
| Molecular Formula | C26H29F3N4O4S |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 2-methoxy-N-[3-[4-(4-morpholin-4-ylphenyl)-2-[4-(trifluoromethoxy)phenyl]imino-1,3-thiazol-3-yl]propyl]acetamide |
| SMILES | COCC(=O)NCCCn1c(-c2ccc(N3CCOCC3)cc2)cs/c1=N\c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H29F3N4O4S/c1-35-17-24(34)30-11-2-12-33-23(19-3-7-21(8-4-19)32-13-15-36-16-14-32)18-38-25(33)31-20-5-9-22(10-6-20)37-26(27,28)29/h3-10,18H,2,11-17H2,1H3,(H,30,34)/b31-25- |
| InChIKey | JGBBLDFDKLEUBL-GDWJVWIDSA-N |
| XLogP | 4.34 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|