C30H31FN4O2S — CID 20815487
N-[3-[2-(4-fluorophenyl)imino-4-(4-morpholin-4-ylphenyl)-1,3-thiazol-3-yl]propyl]-2-phenylacetamide (PubChem CID 20815487) has the molecular formula C30H31FN4O2S and a molecular weight of 530.67 g/mol. Its IUPAC name is N-[3-[2-(4-fluorophenyl)imino-4-(4-morpholin-4-ylphenyl)-1,3-thiazol-3-yl]propyl]-2-phenylacetamide.
| Compound Name | N-[3-[2-(4-fluorophenyl)imino-4-(4-morpholin-4-ylphenyl)-1,3-thiazol-3-yl]propyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 20815487 |
| Molecular Formula | C30H31FN4O2S |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | N-[3-[2-(4-fluorophenyl)imino-4-(4-morpholin-4-ylphenyl)-1,3-thiazol-3-yl]propyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCCCn1c(-c2ccc(N3CCOCC3)cc2)cs/c1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C30H31FN4O2S/c31-25-9-11-26(12-10-25)33-30-35(16-4-15-32-29(36)21-23-5-2-1-3-6-23)28(22-38-30)24-7-13-27(14-8-24)34-17-19-37-20-18-34/h1-3,5-14,22H,4,15-21H2,(H,32,36)/b33-30- |
| InChIKey | CSKHWGWQVMNONU-MEIHLTSWSA-N |
| XLogP | 5.17 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|