C29H37FN6O2S — CID 20815219
1-[3-[2-(4-fluorophenyl)imino-4-(4-morpholin-4-ylphenyl)-1,3-thiazol-3-yl]propyl]-3-(2-pyrrolidin-1-ylethyl)urea (PubChem CID 20815219) has the molecular formula C29H37FN6O2S and a molecular weight of 552.72 g/mol. Its IUPAC name is 1-[3-[2-(4-fluorophenyl)imino-4-(4-morpholin-4-ylphenyl)-1,3-thiazol-3-yl]propyl]-3-(2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-[3-[2-(4-fluorophenyl)imino-4-(4-morpholin-4-ylphenyl)-1,3-thiazol-3-yl]propyl]-3-(2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 20815219 |
| Molecular Formula | C29H37FN6O2S |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 1-[3-[2-(4-fluorophenyl)imino-4-(4-morpholin-4-ylphenyl)-1,3-thiazol-3-yl]propyl]-3-(2-pyrrolidin-1-ylethyl)urea |
| SMILES | O=C(NCCCn1c(-c2ccc(N3CCOCC3)cc2)cs/c1=N\c1ccc(F)cc1)NCCN1CCCC1 |
| InChI | InChI=1S/C29H37FN6O2S/c30-24-6-8-25(9-7-24)33-29-36(16-3-12-31-28(37)32-13-17-34-14-1-2-15-34)27(22-39-29)23-4-10-26(11-5-23)35-18-20-38-21-19-35/h4-11,22H,1-3,12-21H2,(H2,31,32,37)/b33-29- |
| InChIKey | TVOZWTDAQJJWCT-IYOYZZHUSA-N |
| XLogP | 4.21 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|