C25H28F3N3O5S — CID 22350941
N-[3-[2-[(2,4-dimethoxyphenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]-2-methoxyacetamide (PubChem CID 22350941) has the molecular formula C25H28F3N3O5S and a molecular weight of 539.58 g/mol. Its IUPAC name is N-[3-[2-[(2,4-dimethoxyphenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]-2-methoxyacetamide.
| Compound Name | N-[3-[2-[(2,4-dimethoxyphenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 22350941 |
| Molecular Formula | C25H28F3N3O5S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | N-[3-[2-[(2,4-dimethoxyphenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCCCn1c(-c2ccc(OC(F)(F)F)cc2)cs/c1=N\Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C25H28F3N3O5S/c1-33-15-23(32)29-11-4-12-31-21(17-5-8-19(9-6-17)36-25(26,27)28)16-37-24(31)30-14-18-7-10-20(34-2)13-22(18)35-3/h5-10,13,16H,4,11-12,14-15H2,1-3H3,(H,29,32)/b30-24- |
| InChIKey | HNNJEZSIURRYJR-KRUMMXJUSA-N |
| XLogP | 4.39 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|