C24H25F3N4O4S2 — CID 59749200
N-[3-[(2Z)-2-[(3,5-dimethoxyphenyl)carbamothioylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]acetamide (PubChem CID 59749200) has the molecular formula C24H25F3N4O4S2 and a molecular weight of 554.62 g/mol. Its IUPAC name is N-[3-[(2Z)-2-[(3,5-dimethoxyphenyl)carbamothioylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[(2Z)-2-[(3,5-dimethoxyphenyl)carbamothioylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 59749200 |
| Molecular Formula | C24H25F3N4O4S2 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | N-[3-[(2Z)-2-[(3,5-dimethoxyphenyl)carbamothioylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]acetamide |
| SMILES | COc1cc(NC(=S)/N=c2\scc(-c3ccc(OC(F)(F)F)cc3)n2CCCNC(C)=O)cc(OC)c1 |
| InChI | InChI=1S/C24H25F3N4O4S2/c1-15(32)28-9-4-10-31-21(16-5-7-18(8-6-16)35-24(25,26)27)14-37-23(31)30-22(36)29-17-11-19(33-2)13-20(12-17)34-3/h5-8,11-14H,4,9-10H2,1-3H3,(H,28,32)(H,29,36)/b30-23- |
| InChIKey | SIAAZODOESFRME-WMMMYUQOSA-N |
| XLogP | 4.96 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|