C27H31F3N4O5S — CID 20815542
N-[3-[3-(butylcarbamoylamino)propyl]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]-2,4-dimethoxybenzamide (PubChem CID 20815542) has the molecular formula C27H31F3N4O5S and a molecular weight of 580.63 g/mol. Its IUPAC name is N-[3-[3-(butylcarbamoylamino)propyl]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]-2,4-dimethoxybenzamide.
| Compound Name | N-[3-[3-(butylcarbamoylamino)propyl]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 20815542 |
| Molecular Formula | C27H31F3N4O5S |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | N-[3-[3-(butylcarbamoylamino)propyl]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]-2,4-dimethoxybenzamide |
| SMILES | CCCCNC(=O)NCCCn1c(-c2ccc(OC(F)(F)F)cc2)cs/c1=N\C(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C27H31F3N4O5S/c1-4-5-13-31-25(36)32-14-6-15-34-22(18-7-9-19(10-8-18)39-27(28,29)30)17-40-26(34)33-24(35)21-12-11-20(37-2)16-23(21)38-3/h7-12,16-17H,4-6,13-15H2,1-3H3,(H2,31,32,36)/b33-26- |
| InChIKey | VPKRYCQZZSOYTC-MKFPQRGTSA-N |
| XLogP | 5.36 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|