C25H26ClF3N4O4S — CID 142261279
tert-butyl N-[3-[2-(2-chloro-6-methylpyridine-3-carbonyl)imino-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]carbamate (PubChem CID 142261279) has the molecular formula C25H26ClF3N4O4S and a molecular weight of 571.02 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(2-chloro-6-methylpyridine-3-carbonyl)imino-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(2-chloro-6-methylpyridine-3-carbonyl)imino-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]carbamate |
|---|---|
| PubChem CID | 142261279 |
| Molecular Formula | C25H26ClF3N4O4S |
| Molecular Weight | 571.02 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | tert-butyl N-[3-[2-(2-chloro-6-methylpyridine-3-carbonyl)imino-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]carbamate |
| SMILES | Cc1ccc(C(=O)/N=c2\scc(-c3ccc(OC(F)(F)F)cc3)n2CCCNC(=O)OC(C)(C)C)c(Cl)n1 |
| InChI | InChI=1S/C25H26ClF3N4O4S/c1-15-6-11-18(20(26)31-15)21(34)32-22-33(13-5-12-30-23(35)37-24(2,3)4)19(14-38-22)16-7-9-17(10-8-16)36-25(27,28)29/h6-11,14H,5,12-13H2,1-4H3,(H,30,35)/b32-22- |
| InChIKey | BSYQLVRFURJOBU-JDCMOKTRSA-N |
| XLogP | 6.13 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.02 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|