C24H26F3N3O5S — CID 20815507
N-[3-[3-(2-hydroxyethylamino)propyl]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]-2,4-dimethoxybenzamide (PubChem CID 20815507) has the molecular formula C24H26F3N3O5S and a molecular weight of 525.55 g/mol. Its IUPAC name is N-[3-[3-(2-hydroxyethylamino)propyl]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]-2,4-dimethoxybenzamide.
| Compound Name | N-[3-[3-(2-hydroxyethylamino)propyl]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 20815507 |
| Molecular Formula | C24H26F3N3O5S |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | N-[3-[3-(2-hydroxyethylamino)propyl]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-ylidene]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)/N=c2\scc(-c3ccc(OC(F)(F)F)cc3)n2CCCNCCO)c(OC)c1 |
| InChI | InChI=1S/C24H26F3N3O5S/c1-33-18-8-9-19(21(14-18)34-2)22(32)29-23-30(12-3-10-28-11-13-31)20(15-36-23)16-4-6-17(7-5-16)35-24(25,26)27/h4-9,14-15,28,31H,3,10-13H2,1-2H3/b29-23- |
| InChIKey | JOPTZCQRJTUZDB-FAJYDZGRSA-N |
| XLogP | 3.85 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|