C22H24N2O3S — CID 25260431
2,4-dimethoxy-N-[3-methyl-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]benzamide (PubChem CID 25260431) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[3-methyl-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | 2,4-dimethoxy-N-[3-methyl-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 25260431 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2,4-dimethoxy-N-[3-methyl-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-ylidene]benzamide |
| SMILES | COc1ccc(C(=O)/N=c2\scc(-c3c(C)cc(C)cc3C)n2C)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O3S/c1-13-9-14(2)20(15(3)10-13)18-12-28-22(24(18)4)23-21(25)17-8-7-16(26-5)11-19(17)27-6/h7-12H,1-6H3/b23-22- |
| InChIKey | YPINTWJZVWUVHM-FCQUAONHSA-N |
| XLogP | 4.44 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|