C25H30N4O5S — CID 142261346
N-[3-[3-[(2-methoxyacetyl)amino]propyl]-4-(4-propan-2-yloxyphenyl)-1,3-thiazol-2-ylidene]-6-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 142261346) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is N-[3-[3-[(2-methoxyacetyl)amino]propyl]-4-(4-propan-2-yloxyphenyl)-1,3-thiazol-2-ylidene]-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[3-[3-[(2-methoxyacetyl)amino]propyl]-4-(4-propan-2-yloxyphenyl)-1,3-thiazol-2-ylidene]-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142261346 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N-[3-[3-[(2-methoxyacetyl)amino]propyl]-4-(4-propan-2-yloxyphenyl)-1,3-thiazol-2-ylidene]-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | COCC(=O)NCCCn1c(-c2ccc(OC(C)C)cc2)cs/c1=N\C(=O)c1c[nH]c(C)cc1=O |
| InChI | InChI=1S/C25H30N4O5S/c1-16(2)34-19-8-6-18(7-9-19)21-15-35-25(29(21)11-5-10-26-23(31)14-33-4)28-24(32)20-13-27-17(3)12-22(20)30/h6-9,12-13,15-16H,5,10-11,14H2,1-4H3,(H,26,31)(H,27,30)/b28-25- |
| InChIKey | BAAHARMTDIXRNS-FVDSYPCUSA-N |
| XLogP | 2.89 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|