C26H32N4O4S — CID 142261330
N-[4-(4-ethoxyphenyl)-3-[3-(pentanoylamino)propyl]-1,3-thiazol-2-ylidene]-6-(hydroxymethyl)pyridine-3-carboxamide (PubChem CID 142261330) has the molecular formula C26H32N4O4S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-3-[3-(pentanoylamino)propyl]-1,3-thiazol-2-ylidene]-6-(hydroxymethyl)pyridine-3-carboxamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-3-[3-(pentanoylamino)propyl]-1,3-thiazol-2-ylidene]-6-(hydroxymethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142261330 |
| Molecular Formula | C26H32N4O4S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-3-[3-(pentanoylamino)propyl]-1,3-thiazol-2-ylidene]-6-(hydroxymethyl)pyridine-3-carboxamide |
| SMILES | CCCCC(=O)NCCCn1c(-c2ccc(OCC)cc2)cs/c1=N\C(=O)c1ccc(CO)nc1 |
| InChI | InChI=1S/C26H32N4O4S/c1-3-5-7-24(32)27-14-6-15-30-23(19-9-12-22(13-10-19)34-4-2)18-35-26(30)29-25(33)20-8-11-21(17-31)28-16-20/h8-13,16,18,31H,3-7,14-15,17H2,1-2H3,(H,27,32)/b29-26- |
| InChIKey | APDZFPYKGXRTQX-WCTVFOPTSA-N |
| XLogP | 3.94 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|