C27H37N3O3S2 — CID 18812946
4-[2-(4-ethoxyphenyl)imino-3-hexyl-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 18812946) has the molecular formula C27H37N3O3S2 and a molecular weight of 515.75 g/mol. Its IUPAC name is 4-[2-(4-ethoxyphenyl)imino-3-hexyl-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[2-(4-ethoxyphenyl)imino-3-hexyl-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 18812946 |
| Molecular Formula | C27H37N3O3S2 |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 4-[2-(4-ethoxyphenyl)imino-3-hexyl-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCCCCCn1c(-c2ccc(S(=O)(=O)N(CC)CC)cc2)cs/c1=N\c1ccc(OCC)cc1 |
| InChI | InChI=1S/C27H37N3O3S2/c1-5-9-10-11-20-30-26(21-34-27(30)28-23-14-16-24(17-15-23)33-8-4)22-12-18-25(19-13-22)35(31,32)29(6-2)7-3/h12-19,21H,5-11,20H2,1-4H3/b28-27- |
| InChIKey | QPEQLRBDXNFDPF-DQSJHHFOSA-N |
| XLogP | 6.46 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|