C27H29N3O2S2 — CID 3980869
N,N-diethyl-4-[3-(2-phenylethyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 3980869) has the molecular formula C27H29N3O2S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is N,N-diethyl-4-[3-(2-phenylethyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[3-(2-phenylethyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3980869 |
| Molecular Formula | C27H29N3O2S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N,N-diethyl-4-[3-(2-phenylethyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2cs/c(=N\c3ccccc3)n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O2S2/c1-3-29(4-2)34(31,32)25-17-15-23(16-18-25)26-21-33-27(28-24-13-9-6-10-14-24)30(26)20-19-22-11-7-5-8-12-22/h5-18,21H,3-4,19-20H2,1-2H3/b28-27- |
| InChIKey | DZQABOBRNTXZQB-DQSJHHFOSA-N |
| XLogP | 5.72 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|