C28H38N4O4S2 — CID 18813069
4-[2-(4-ethoxyphenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 18813069) has the molecular formula C28H38N4O4S2 and a molecular weight of 558.77 g/mol. Its IUPAC name is 4-[2-(4-ethoxyphenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[2-(4-ethoxyphenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 18813069 |
| Molecular Formula | C28H38N4O4S2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 4-[2-(4-ethoxyphenyl)imino-3-(3-morpholin-4-ylpropyl)-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCOc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N(CC)CC)cc3)n2CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C28H38N4O4S2/c1-4-31(5-2)38(33,34)26-14-8-23(9-15-26)27-22-37-28(29-24-10-12-25(13-11-24)36-6-3)32(27)17-7-16-30-18-20-35-21-19-30/h8-15,22H,4-7,16-21H2,1-3H3/b29-28- |
| InChIKey | MNTTUOWXCGLHLR-ZIADKAODSA-N |
| XLogP | 4.60 |
| TPSA | 76.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|