C24H31N3O4S2 — CID 18813011
4-[2-(4-ethoxyphenyl)imino-3-(2-methoxyethyl)-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 18813011) has the molecular formula C24H31N3O4S2 and a molecular weight of 489.66 g/mol. Its IUPAC name is 4-[2-(4-ethoxyphenyl)imino-3-(2-methoxyethyl)-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[2-(4-ethoxyphenyl)imino-3-(2-methoxyethyl)-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 18813011 |
| Molecular Formula | C24H31N3O4S2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 4-[2-(4-ethoxyphenyl)imino-3-(2-methoxyethyl)-1,3-thiazol-4-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCOc1ccc(/N=c2\scc(-c3ccc(S(=O)(=O)N(CC)CC)cc3)n2CCOC)cc1 |
| InChI | InChI=1S/C24H31N3O4S2/c1-5-26(6-2)33(28,29)22-14-8-19(9-15-22)23-18-32-24(27(23)16-17-30-4)25-20-10-12-21(13-11-20)31-7-3/h8-15,18H,5-7,16-17H2,1-4H3/b25-24- |
| InChIKey | XEZNHXXBAIQKDL-IZHYLOQSSA-N |
| XLogP | 4.52 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|