C23H25Cl2N3O2S — CID 138392833
4-(3,4-dichlorophenyl)-N-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine (PubChem CID 138392833) has the molecular formula C23H25Cl2N3O2S and a molecular weight of 478.45 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 138392833 |
| Molecular Formula | C23H25Cl2N3O2S |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-(4-ethoxyphenyl)-3-(2-morpholin-4-ylethyl)-1,3-thiazol-2-imine |
| SMILES | CCOc1ccc(/N=c2\scc(-c3ccc(Cl)c(Cl)c3)n2CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H25Cl2N3O2S/c1-2-30-19-6-4-18(5-7-19)26-23-28(10-9-27-11-13-29-14-12-27)22(16-31-23)17-3-8-20(24)21(25)15-17/h3-8,15-16H,2,9-14H2,1H3/b26-23- |
| InChIKey | WWOQCMWJCXRMPY-RWEWTDSWSA-N |
| XLogP | 5.49 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|