C25H25N3O2S2 — CID 5229362
N,N-dimethyl-4-[3-(2-phenylethyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 5229362) has the molecular formula C25H25N3O2S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-(2-phenylethyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[3-(2-phenylethyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 5229362 |
| Molecular Formula | C25H25N3O2S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N,N-dimethyl-4-[3-(2-phenylethyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2cs/c(=N\c3ccccc3)n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O2S2/c1-27(2)32(29,30)23-15-13-21(14-16-23)24-19-31-25(26-22-11-7-4-8-12-22)28(24)18-17-20-9-5-3-6-10-20/h3-16,19H,17-18H2,1-2H3/b26-25- |
| InChIKey | QLENVDCTBIBXJP-QPLCGJKRSA-N |
| XLogP | 4.94 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|