C25H30N6O3S — CID 142261304
N-[4-(4-ethoxyphenyl)-3-[5-(ethylamino)-4-imino-5-oxopentyl]-1,3-thiazol-2-ylidene]-4-(methylamino)pyridine-3-carboxamide (PubChem CID 142261304) has the molecular formula C25H30N6O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-3-[5-(ethylamino)-4-imino-5-oxopentyl]-1,3-thiazol-2-ylidene]-4-(methylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-3-[5-(ethylamino)-4-imino-5-oxopentyl]-1,3-thiazol-2-ylidene]-4-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142261304 |
| Molecular Formula | C25H30N6O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-3-[5-(ethylamino)-4-imino-5-oxopentyl]-1,3-thiazol-2-ylidene]-4-(methylamino)pyridine-3-carboxamide |
| SMILES | [H]/N=C(/CCCn1c(-c2ccc(OCC)cc2)cs/c1=N\C(=O)c1cnccc1NC)C(=O)NCC |
| InChI | InChI=1S/C25H30N6O3S/c1-4-29-24(33)20(26)7-6-14-31-22(17-8-10-18(11-9-17)34-5-2)16-35-25(31)30-23(32)19-15-28-13-12-21(19)27-3/h8-13,15-16,26H,4-7,14H2,1-3H3,(H,27,28)(H,29,33)/b26-20-,30-25- |
| InChIKey | OMMFZOOWOUVRJL-KWNKCFODSA-N |
| XLogP | 3.73 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|